C24H32N2O9P+ — CID 130187461
propan-2-yl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 130187461) has the molecular formula C24H32N2O9P+ and a molecular weight of 523.50 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130187461 |
| Molecular Formula | C24H32N2O9P+ |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(=O)c1ccc[n+]([C@@H]2O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)C(O)[C@@H]2O)c1 |
| InChI | InChI=1S/C24H32N2O9P/c1-15(2)33-24(30)16(3)25-36(31,35-19-10-6-5-7-11-19)32-14-20-21(28)22(29)23(34-20)26-12-8-9-18(13-26)17(4)27/h5-13,15-16,20-23,28-29H,14H2,1-4H3,(H,25,31)/q+1/t16-,20+,21?,22-,23+,36-/m0/s1 |
| InChIKey | UTRSCENWBWQVKR-CZOXRILWSA-N |
| XLogP | 1.93 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|