C30H38N2O9P+ — CID 157083623
2,2-dimethylpropyl (2S)-2-[[[(2R,3R,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 157083623) has the molecular formula C30H38N2O9P+ and a molecular weight of 601.61 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 157083623 |
| Molecular Formula | C30H38N2O9P+ |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc3cccc4ccccc34)[C@H](O)C2O)c1 |
| InChI | InChI=1S/C30H38N2O9P/c1-19(29(36)38-18-30(3,4)5)31-42(37,41-24-14-8-11-21-10-6-7-13-23(21)24)39-17-25-26(34)27(35)28(40-25)32-15-9-12-22(16-32)20(2)33/h6-16,19,25-28,34-35H,17-18H2,1-5H3,(H,31,37)/q+1/t19-,25+,26-,27?,28+,42?/m0/s1 |
| InChIKey | ADDNFXKJHKTOKM-OUMAAFBRSA-N |
| XLogP | 3.72 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|