C29H35BrN3O9P — CID 134149035
2,2-dimethylpropyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 134149035) has the molecular formula C29H35BrN3O9P and a molecular weight of 680.49 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134149035 |
| Molecular Formula | C29H35BrN3O9P |
| Molecular Weight | 680.49 g/mol |
| Exact Mass | 679.13 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)C[C@@H]1O)Oc1cccc2ccccc12)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C29H35BrN3O9P/c1-18(27(36)39-17-29(2,3)4)32-43(38,42-23-11-7-9-19-8-5-6-10-21(19)23)40-16-24-22(34)14-25(41-24)33-15-20(12-13-30)26(35)31-28(33)37/h5-13,15,18,22,24-25,34H,14,16-17H2,1-4H3,(H,32,38)(H,31,35,37)/b13-12+/t18-,22-,24+,25+,43?/m0/s1 |
| InChIKey | LSUMZOOBUAPZFJ-QISPMZTOSA-N |
| XLogP | 4.47 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|