C30H35BrN3O9P — CID 134150815
cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 134150815) has the molecular formula C30H35BrN3O9P and a molecular weight of 692.50 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134150815 |
| Molecular Formula | C30H35BrN3O9P |
| Molecular Weight | 692.50 g/mol |
| Exact Mass | 691.13 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)C[C@@H]1O)Oc1cccc2ccccc12)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C30H35BrN3O9P/c1-19(29(37)41-22-10-3-2-4-11-22)33-44(39,43-25-13-7-9-20-8-5-6-12-23(20)25)40-18-26-24(35)16-27(42-26)34-17-21(14-15-31)28(36)32-30(34)38/h5-9,12-15,17,19,22,24,26-27,35H,2-4,10-11,16,18H2,1H3,(H,33,39)(H,32,36,38)/b15-14+/t19-,24-,26+,27+,44?/m0/s1 |
| InChIKey | DQGRIAJRGTYASE-DIXIVPOBSA-N |
| XLogP | 4.76 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|