C23H31ClN3O9P — CID 138470194
propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride (PubChem CID 138470194) has the molecular formula C23H31ClN3O9P and a molecular weight of 559.94 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride |
|---|---|
| PubChem CID | 138470194 |
| Molecular Formula | C23H31ClN3O9P |
| Molecular Weight | 559.94 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O)Oc1ccccc1.[Cl-] |
| InChI | InChI=1S/C23H30N3O9P.ClH/c1-14(2)33-23(30)15(3)25-36(31,35-17-9-5-4-6-10-17)32-13-18-19(27)20(28)22(34-18)26-11-7-8-16(12-26)21(24)29;/h4-12,14-15,18-20,22,27-28H,13H2,1-3H3,(H2-,24,25,29,31);1H/t15-,18+,19+,20+,22+,36?;/m0./s1 |
| InChIKey | XZXQNRPGBKBVHE-LIMNDHDMSA-N |
| XLogP | -2.17 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.94 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|