C31H33N3O9P+ — CID 147783238
benzyl (2S)-2-[[[(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 147783238) has the molecular formula C31H33N3O9P+ and a molecular weight of 622.59 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 147783238 |
| Molecular Formula | C31H33N3O9P+ |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)C(O)C1O)Oc1cccc2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H32N3O9P/c1-20(31(38)40-18-21-9-3-2-4-10-21)33-44(39,43-25-15-7-12-22-11-5-6-14-24(22)25)41-19-26-27(35)28(36)30(42-26)34-16-8-13-23(17-34)29(32)37/h2-17,20,26-28,30,35-36H,18-19H2,1H3,(H2-,32,33,37,39)/p+1/t20-,26+,27?,28?,30+,44?/m0/s1 |
| InChIKey | CPVCNRBGFFREMM-RWZZHIIRSA-O |
| XLogP | 2.77 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|