C31H37N3O9P+ — CID 130187484
benzyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 130187484) has the molecular formula C31H37N3O9P+ and a molecular weight of 626.62 g/mol. Its IUPAC name is benzyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | benzyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130187484 |
| Molecular Formula | C31H37N3O9P+ |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | benzyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | Cc1ccc(OP(=O)(NC(C)C(=O)OCc2ccccc2)OCC2O[C@@H]([n+]3cccc(C(N)=O)c3)[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C31H36N3O9P/c1-20-12-14-24(15-13-20)43-44(37,33-21(2)30(36)38-18-22-9-6-5-7-10-22)39-19-25-26-27(42-31(3,4)41-26)29(40-25)34-16-8-11-23(17-34)28(32)35/h5-17,21,25-27,29H,18-19H2,1-4H3,(H2-,32,33,35,37)/p+1/t21?,25?,26-,27-,29-,44?/m1/s1 |
| InChIKey | IZWMEASJYKYZIE-GJVNLFGBSA-O |
| XLogP | 3.72 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|