C29H34N2O9P+ — CID 130187462
benzyl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 130187462) has the molecular formula C29H34N2O9P+ and a molecular weight of 585.57 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130187462 |
| Molecular Formula | C29H34N2O9P+ |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(N[C@@H](C)C(=O)OCc3ccccc3)Oc3ccc(C)cc3)C(O)[C@@H]2O)c1 |
| InChI | InChI=1S/C29H34N2O9P/c1-19-11-13-24(14-12-19)40-41(36,30-20(2)29(35)37-17-22-8-5-4-6-9-22)38-18-25-26(33)27(34)28(39-25)31-15-7-10-23(16-31)21(3)32/h4-16,20,25-28,33-34H,17-18H2,1-3H3,(H,30,36)/q+1/t20-,25+,26?,27-,28+,41?/m0/s1 |
| InChIKey | OOZVPUZRPQTWCM-MSAIHZCSSA-N |
| XLogP | 3.03 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|