C24H27N4O10P — CID 164541138
benzyl (2S)-2-[[[(2R,4S,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 164541138) has the molecular formula C24H27N4O10P and a molecular weight of 562.47 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,4S,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,4S,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 164541138 |
| Molecular Formula | C24H27N4O10P |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,4S,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ncc(=O)[nH]c2=O)[C@@H](O)C1O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H27N4O10P/c1-15(23(32)35-13-16-8-4-2-5-9-16)27-39(34,38-17-10-6-3-7-11-17)36-14-18-20(30)21(31)22(37-18)28-24(33)26-19(29)12-25-28/h2-12,15,18,20-22,30-31H,13-14H2,1H3,(H,27,34)(H,26,29,33)/t15-,18+,20?,21-,22+,39?/m0/s1 |
| InChIKey | XPYQCUAWSGLCFW-PWCJFRONSA-N |
| XLogP | 0.48 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|