C25H29N4O9P — CID 165068937
benzyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 165068937) has the molecular formula C25H29N4O9P and a molecular weight of 560.50 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 165068937 |
| Molecular Formula | C25H29N4O9P |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1NC(=O)C=NN1[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCc2ccccc2)Oc2ccccc2)C(O)[C@@H]1O |
| InChI | InChI=1S/C25H29N4O9P/c1-16(25(33)35-14-18-9-5-3-6-10-18)28-39(34,38-19-11-7-4-8-12-19)36-15-20-22(31)23(32)24(37-20)29-17(2)27-21(30)13-26-29/h3-13,16,20,22-24,31-32H,2,14-15H2,1H3,(H,27,30)(H,28,34)/t16-,20+,22?,23-,24+,39?/m0/s1 |
| InChIKey | XGKQZGDZYIWVDX-QCNQZLCRSA-N |
| XLogP | 1.25 |
| TPSA | 168.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|