C28H29ClN3O9P — CID 118314714
benzyl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 118314714) has the molecular formula C28H29ClN3O9P and a molecular weight of 617.98 g/mol. Its IUPAC name is benzyl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118314714 |
| Molecular Formula | C28H29ClN3O9P |
| Molecular Weight | 617.98 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | benzyl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OCc2ccccc2)Oc2ccc(Cl)cc2)O[C@H]1N1C=CC(=O)NC1=C |
| InChI | InChI=1S/C28H29ClN3O9P/c1-4-28(36)25(34)23(40-27(28)32-15-14-24(33)30-19(32)3)17-39-42(37,41-22-12-10-21(29)11-13-22)31-18(2)26(35)38-16-20-8-6-5-7-9-20/h1,5-15,18,23,25,27,34,36H,3,16-17H2,2H3,(H,30,33)(H,31,37)/t18-,23+,25+,27+,28+,42?/m0/s1 |
| InChIKey | LLYPCLHMOKTIEB-MMRORTBGSA-N |
| XLogP | 2.43 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.98 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|