C25H28F2N4O8P+ — CID 148628894
benzyl (2S)-2-[[[(2R,5R)-5-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 148628894) has the molecular formula C25H28F2N4O8P+ and a molecular weight of 581.49 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,5R)-5-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,5R)-5-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 148628894 |
| Molecular Formula | C25H28F2N4O8P+ |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,5R)-5-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@](=O)(OC[C@H]1O[C@@H]([n+]2ccc(N)[nH]c2=O)C(F)(F)C1O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H27F2N4O8P/c1-16(22(33)36-14-17-8-4-2-5-9-17)30-40(35,39-18-10-6-3-7-11-18)37-15-19-21(32)25(26,27)23(38-19)31-13-12-20(28)29-24(31)34/h2-13,16,19,21,23,32H,14-15H2,1H3,(H3,28,29,30,34,35)/p+1/t16-,19+,21?,23+,40-/m0/s1 |
| InChIKey | YLCGAKVXAYXTEC-DHRWINLPSA-O |
| XLogP | 2.06 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|