C28H39N3O9P+ — CID 126555050
2,2-dimethylpropyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126555050) has the molecular formula C28H39N3O9P+ and a molecular weight of 592.61 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126555050 |
| Molecular Formula | C28H39N3O9P+ |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 2,2-dimethylpropyl 2-[[[(3aR,4R,6aR)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OCC1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@@H]2OC(C)(C)O[C@H]12)Oc1ccccc1)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C28H38N3O9P/c1-18(26(33)35-17-27(2,3)4)30-41(34,40-20-12-8-7-9-13-20)36-16-21-22-23(39-28(5,6)38-22)25(37-21)31-14-10-11-19(15-31)24(29)32/h7-15,18,21-23,25H,16-17H2,1-6H3,(H2-,29,30,32,34)/p+1/t18?,21?,22-,23-,25-,41?/m1/s1 |
| InChIKey | YMFBEOINKRLBOW-AYOWTVGISA-O |
| XLogP | 3.26 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|