C23H30ClN2O8PS — CID 157361136
propan-2-yl (2S)-3-[[(2S,4R,5S)-4-chloro-3-hydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 157361136) has the molecular formula C23H30ClN2O8PS and a molecular weight of 560.99 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[(2S,4R,5S)-4-chloro-3-hydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[(2S,4R,5S)-4-chloro-3-hydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 157361136 |
| Molecular Formula | C23H30ClN2O8PS |
| Molecular Weight | 560.99 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | propan-2-yl (2S)-3-[[(2S,4R,5S)-4-chloro-3-hydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | Cc1cn([C@H]2O[C@@H](CO[P@](=O)(C[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)C(O)[C@H]2Cl)c(=S)[nH]c1=O |
| InChI | InChI=1S/C23H30ClN2O8PS/c1-13(2)32-22(29)15(4)12-35(30,34-16-8-6-5-7-9-16)31-11-17-19(27)18(24)21(33-17)26-10-14(3)20(28)25-23(26)36/h5-10,13,15,17-19,21,27H,11-12H2,1-4H3,(H,25,28,36)/t15-,17+,18-,19?,21+,35-/m1/s1 |
| InChIKey | NIUGOWJTCVJZNX-CNRRUKEQSA-N |
| XLogP | 3.96 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.99 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|