C23H31N2O10P — CID 157210662
propan-2-yl (2S)-3-[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 157210662) has the molecular formula C23H31N2O10P and a molecular weight of 526.48 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 157210662 |
| Molecular Formula | C23H31N2O10P |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | propan-2-yl (2S)-3-[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | Cc1cn([C@H]2O[C@@H](COP(=O)(C[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)C(O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H31N2O10P/c1-13(2)33-22(29)15(4)12-36(31,35-16-8-6-5-7-9-16)32-11-17-18(26)19(27)21(34-17)25-10-14(3)20(28)24-23(25)30/h5-10,13,15,17-19,21,26-27H,11-12H2,1-4H3,(H,24,28,30)/t15-,17+,18?,19-,21+,36?/m1/s1 |
| InChIKey | GKQIBQXJIBKZJN-VAWMQSFYSA-N |
| XLogP | 1.34 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|