C24H21N2O7P — CID 177261327
[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl diphenyl phosphate (PubChem CID 177261327) has the molecular formula C24H21N2O7P and a molecular weight of 480.41 g/mol. Its IUPAC name is [(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl diphenyl phosphate.
| Compound Name | [(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl diphenyl phosphate |
|---|---|
| PubChem CID | 177261327 |
| Molecular Formula | C24H21N2O7P |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl diphenyl phosphate |
| SMILES | C#C[C@@]1(COP(=O)(Oc2ccccc2)Oc2ccccc2)C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C24H21N2O7P/c1-3-24(15-14-21(31-24)26-16-18(2)22(27)25-23(26)28)17-30-34(29,32-19-10-6-4-7-11-19)33-20-12-8-5-9-13-20/h1,4-16,21H,17H2,2H3,(H,25,27,28)/t21-,24+/m1/s1 |
| InChIKey | CBZFXSUEBZWCGQ-QPPBQGQZSA-N |
| XLogP | 3.58 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|