C14H14N2O4 — CID 176809410
5-cyclopropyl-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione (PubChem CID 176809410) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-cyclopropyl-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-cyclopropyl-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 176809410 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-cyclopropyl-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@@]1(CO)C=C[C@H](n2cc(C3CC3)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C14H14N2O4/c1-2-14(8-17)6-5-11(20-14)16-7-10(9-3-4-9)12(18)15-13(16)19/h1,5-7,9,11,17H,3-4,8H2,(H,15,18,19)/t11-,14+/m1/s1 |
| InChIKey | ILRMQSNOKKDGNW-RISCZKNCSA-N |
| XLogP | -0.14 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|