C19H17N2O7P — CID 177261355
1-[(2R,5R)-5-ethynyl-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 177261355) has the molecular formula C19H17N2O7P and a molecular weight of 416.33 g/mol. Its IUPAC name is 1-[(2R,5R)-5-ethynyl-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-ethynyl-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177261355 |
| Molecular Formula | C19H17N2O7P |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-[(2R,5R)-5-ethynyl-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C#C[C@@]1(CO[P@]2(=O)OCc3ccccc3O2)C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C19H17N2O7P/c1-3-19(9-8-16(27-19)21-10-13(2)17(22)20-18(21)23)12-26-29(24)25-11-14-6-4-5-7-15(14)28-29/h1,4-10,16H,11-12H2,2H3,(H,20,22,23)/t16-,19+,29+/m1/s1 |
| InChIKey | TUXLIWXDOKUPDN-SKBDVJSQSA-N |
| XLogP | 2.04 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|