C19H16FN2O7P — CID 169257162
1-[(2R,5R)-5-ethynyl-5-[(7-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 169257162) has the molecular formula C19H16FN2O7P and a molecular weight of 434.32 g/mol. Its IUPAC name is 1-[(2R,5R)-5-ethynyl-5-[(7-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-ethynyl-5-[(7-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169257162 |
| Molecular Formula | C19H16FN2O7P |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 1-[(2R,5R)-5-ethynyl-5-[(7-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C#C[C@@]1(COP2(=O)OCc3ccc(F)cc3O2)C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C19H16FN2O7P/c1-3-19(7-6-16(28-19)22-9-12(2)17(23)21-18(22)24)11-27-30(25)26-10-13-4-5-14(20)8-15(13)29-30/h1,4-9,16H,10-11H2,2H3,(H,21,23,24)/t16-,19+,30?/m1/s1 |
| InChIKey | ZSOPRRCENAIKPK-VFSQBQNXSA-N |
| XLogP | 2.18 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|