C17H15F4N2O8P — CID 118302327
1-[(2R,3S,4R,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 118302327) has the molecular formula C17H15F4N2O8P and a molecular weight of 482.28 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118302327 |
| Molecular Formula | C17H15F4N2O8P |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@@](COP3(=O)OCc4ccccc4O3)(C(F)F)[C@H](F)[C@H]2O)cc1F |
| InChI | InChI=1S/C17H15F4N2O8P/c18-9-5-23(16(26)22-13(9)25)14-11(24)12(19)17(30-14,15(20)21)7-29-32(27)28-6-8-3-1-2-4-10(8)31-32/h1-5,11-12,14-15,24H,6-7H2,(H,22,25,26)/t11-,12-,14-,17-,32?/m1/s1 |
| InChIKey | TZVOAUTZPZQHAX-FGKGHICJSA-N |
| XLogP | 1.64 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|