C18H17F3NO8P — CID 158624656
1-[(2R,3S,4S,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyridine-2,4-dione (PubChem CID 158624656) has the molecular formula C18H17F3NO8P and a molecular weight of 463.30 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 158624656 |
| Molecular Formula | C18H17F3NO8P |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-5-(difluoromethyl)-4-fluoro-3-hydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyridine-2,4-dione |
| SMILES | O=C1C=CN([C@@H]2O[C@@](COP3(=O)OCc4ccccc4O3)(C(F)F)[C@@H](F)[C@H]2O)C(=O)C1 |
| InChI | InChI=1S/C18H17F3NO8P/c19-15-14(25)16(22-6-5-11(23)7-13(22)24)29-18(15,17(20)21)9-28-31(26)27-8-10-3-1-2-4-12(10)30-31/h1-6,14-17,25H,7-9H2/t14-,15+,16-,18-,31?/m1/s1 |
| InChIKey | HYKXVFCGVIAGRZ-GBGLFCFOSA-N |
| XLogP | 2.09 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|