C18H15F5NO7PS — CID 161272338
1-[(2R,3S,5S)-5-(difluoromethyl)-4,4-difluoro-3-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyridine-2,4-dione (PubChem CID 161272338) has the molecular formula C18H15F5NO7PS and a molecular weight of 515.35 g/mol. Its IUPAC name is 1-[(2R,3S,5S)-5-(difluoromethyl)-4,4-difluoro-3-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyridine-2,4-dione.
| Compound Name | 1-[(2R,3S,5S)-5-(difluoromethyl)-4,4-difluoro-3-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyridine-2,4-dione |
|---|---|
| PubChem CID | 161272338 |
| Molecular Formula | C18H15F5NO7PS |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | 1-[(2R,3S,5S)-5-(difluoromethyl)-4,4-difluoro-3-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyridine-2,4-dione |
| SMILES | O=C1CC(=O)N([C@@H]2O[C@@](COP3(=S)OCc4ccccc4O3)(C(F)F)C(F)(F)[C@H]2O)C=C1F |
| InChI | InChI=1S/C18H15F5NO7PS/c19-10-6-24(13(26)5-11(10)25)15-14(27)18(22,23)17(30-15,16(20)21)8-29-32(33)28-7-9-3-1-2-4-12(9)31-32/h1-4,6,14-16,27H,5,7-8H2/t14-,15+,17-,32?/m0/s1 |
| InChIKey | VDZGKSMISMRJSV-FHAATIDGSA-N |
| XLogP | 2.81 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|