C17H17F3N3O6PS — CID 118299701
4-amino-1-[(2R,3S,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 118299701) has the molecular formula C17H17F3N3O6PS and a molecular weight of 479.37 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 118299701 |
| Molecular Formula | C17H17F3N3O6PS |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 4-amino-1-[(2R,3S,4R,5R)-5-(difluoromethyl)-3-fluoro-4-hydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@@](COP3(=S)OCc4ccccc4O3)(C(F)F)[C@@H](O)[C@@H]2F)c(=O)n1 |
| InChI | InChI=1S/C17H17F3N3O6PS/c18-12-13(24)17(15(19)20,28-14(12)23-6-5-11(21)22-16(23)25)8-27-30(31)26-7-9-3-1-2-4-10(9)29-30/h1-6,12-15,24H,7-8H2,(H2,21,22,25)/t12-,13-,14+,17+,30?/m0/s1 |
| InChIKey | WXUMUZWQIITNON-LPFDQYAJSA-N |
| XLogP | 1.91 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|