C18H18F2N5O8P — CID 136987295
2-amino-9-[(2R,3S,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 136987295) has the molecular formula C18H18F2N5O8P and a molecular weight of 501.34 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3S,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136987295 |
| Molecular Formula | C18H18F2N5O8P |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 2-amino-9-[(2R,3S,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@@](COP3(=O)OCc4ccccc4O3)(C(F)F)[C@@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H18F2N5O8P/c19-16(20)18(6-31-34(29)30-5-8-3-1-2-4-9(8)33-34)12(27)11(26)15(32-18)25-7-22-10-13(25)23-17(21)24-14(10)28/h1-4,7,11-12,15-16,26-27H,5-6H2,(H3,21,23,24,28)/t11-,12-,15+,18+,34?/m0/s1 |
| InChIKey | PLBYYXKRDJTVRX-GGGBUTSOSA-N |
| XLogP | 0.69 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|