C17H16ClF2N2O8PS — CID 118302544
5-chloro-1-[(2R,3R,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 118302544) has the molecular formula C17H16ClF2N2O8PS and a molecular weight of 512.81 g/mol. Its IUPAC name is 5-chloro-1-[(2R,3R,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[(2R,3R,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118302544 |
| Molecular Formula | C17H16ClF2N2O8PS |
| Molecular Weight | 512.81 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | 5-chloro-1-[(2R,3R,4S,5R)-5-(difluoromethyl)-3,4-dihydroxy-5-[(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@@](COP3(=S)OCc4ccccc4O3)(C(F)F)[C@@H](O)[C@H]2O)cc1Cl |
| InChI | InChI=1S/C17H16ClF2N2O8PS/c18-9-5-22(16(26)21-13(9)25)14-11(23)12(24)17(29-14,15(19)20)7-28-31(32)27-6-8-3-1-2-4-10(8)30-31/h1-5,11-12,14-15,23-24H,6-7H2,(H,21,25,26)/t11-,12+,14-,17-,31?/m1/s1 |
| InChIKey | UQWDBZWRFDPPBD-RFCDWTAVSA-N |
| XLogP | 1.29 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|