C24H24ClF2N2O10PS — CID 118302318
1-[(2R,3S,4S,5R)-5-[bis(4-methoxyphenoxy)phosphinothioyloxymethyl]-5-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]-5-chloropyrimidine-2,4-dione (PubChem CID 118302318) has the molecular formula C24H24ClF2N2O10PS and a molecular weight of 636.95 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-5-[bis(4-methoxyphenoxy)phosphinothioyloxymethyl]-5-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]-5-chloropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-5-[bis(4-methoxyphenoxy)phosphinothioyloxymethyl]-5-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]-5-chloropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118302318 |
| Molecular Formula | C24H24ClF2N2O10PS |
| Molecular Weight | 636.95 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-5-[bis(4-methoxyphenoxy)phosphinothioyloxymethyl]-5-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]-5-chloropyrimidine-2,4-dione |
| SMILES | COc1ccc(OP(=S)(OC[C@@]2(C(F)F)O[C@@H](n3cc(Cl)c(=O)[nH]c3=O)[C@@H](O)[C@@H]2O)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H24ClF2N2O10PS/c1-34-13-3-7-15(8-4-13)38-40(41,39-16-9-5-14(35-2)6-10-16)36-12-24(22(26)27)19(31)18(30)21(37-24)29-11-17(25)20(32)28-23(29)33/h3-11,18-19,21-22,30-31H,12H2,1-2H3,(H,28,32,33)/t18-,19-,21+,24+/m0/s1 |
| InChIKey | MOQAXUXGGLJIBX-JGUFOIBDSA-N |
| XLogP | 2.86 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.95 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|