C24H24ClF2N2O11P — CID 118302239
[(2R,3S,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate (PubChem CID 118302239) has the molecular formula C24H24ClF2N2O11P and a molecular weight of 620.88 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
|---|---|
| PubChem CID | 118302239 |
| Molecular Formula | C24H24ClF2N2O11P |
| Molecular Weight | 620.88 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
| SMILES | COc1ccc(OP(=O)(OC[C@@]2(C(F)F)O[C@@H](n3cc(Cl)c(=O)[nH]c3=O)[C@@H](O)[C@@H]2O)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H24ClF2N2O11P/c1-35-13-3-7-15(8-4-13)39-41(34,40-16-9-5-14(36-2)6-10-16)37-12-24(22(26)27)19(31)18(30)21(38-24)29-11-17(25)20(32)28-23(29)33/h3-11,18-19,21-22,30-31H,12H2,1-2H3,(H,28,32,33)/t18-,19-,21+,24+/m0/s1 |
| InChIKey | OTEKWRWJGFYXRX-JGUFOIBDSA-N |
| XLogP | 2.74 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|