C24H24F3N2O10P — CID 118294184
[(2S,5S)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate (PubChem CID 118294184) has the molecular formula C24H24F3N2O10P and a molecular weight of 588.43 g/mol. Its IUPAC name is [(2S,5S)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate.
| Compound Name | [(2S,5S)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
|---|---|
| PubChem CID | 118294184 |
| Molecular Formula | C24H24F3N2O10P |
| Molecular Weight | 588.43 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | [(2S,5S)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
| SMILES | COc1ccc(OP(=O)(OC[C@]2(C(F)F)O[C@H](n3ccc(=O)[nH]c3=O)C(F)C2O)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H24F3N2O10P/c1-34-14-3-7-16(8-4-14)38-40(33,39-17-9-5-15(35-2)6-10-17)36-13-24(22(26)27)20(31)19(25)21(37-24)29-12-11-18(30)28-23(29)32/h3-12,19-22,31H,13H2,1-2H3,(H,28,30,32)/t19?,20?,21-,24-/m0/s1 |
| InChIKey | ZIBCPQGINWPTKS-PXOOEFRDSA-N |
| XLogP | 3.07 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|