C25H25F3N5O9P — CID 137058007
[5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate (PubChem CID 137058007) has the molecular formula C25H25F3N5O9P and a molecular weight of 627.47 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
|---|---|
| PubChem CID | 137058007 |
| Molecular Formula | C25H25F3N5O9P |
| Molecular Weight | 627.47 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
| SMILES | COc1ccc(OP(=O)(OCC2(C(F)F)OC(n3cnc4c(=O)[nH]c(N)nc43)C(F)C2O)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H25F3N5O9P/c1-37-13-3-7-15(8-4-13)41-43(36,42-16-9-5-14(38-2)6-10-16)39-11-25(23(27)28)19(34)17(26)22(40-25)33-12-30-18-20(33)31-24(29)32-21(18)35/h3-10,12,17,19,22-23,34H,11H2,1-2H3,(H3,29,31,32,35) |
| InChIKey | VFIPAMXODQUORZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 182.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|