C27H28F5N2O9P — CID 161498558
propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-3,3-difluoro-5-(5-fluoro-2,4-dioxo-1-pyridinyl)-4-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 161498558) has the molecular formula C27H28F5N2O9P and a molecular weight of 650.49 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-3,3-difluoro-5-(5-fluoro-2,4-dioxo-1-pyridinyl)-4-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-3,3-difluoro-5-(5-fluoro-2,4-dioxo-1-pyridinyl)-4-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 161498558 |
| Molecular Formula | C27H28F5N2O9P |
| Molecular Weight | 650.49 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-3,3-difluoro-5-(5-fluoro-2,4-dioxo-1-pyridinyl)-4-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(C(F)F)O[C@@H](N2C=C(F)C(=O)CC2=O)[C@H](O)C1(F)F)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C27H28F5N2O9P/c1-14(2)41-24(38)15(3)33-44(39,43-20-10-6-8-16-7-4-5-9-17(16)20)40-13-26(25(29)30)27(31,32)22(37)23(42-26)34-12-18(28)19(35)11-21(34)36/h4-10,12,14-15,22-23,25,37H,11,13H2,1-3H3,(H,33,39)/t15-,22-,23+,26-,44?/m0/s1 |
| InChIKey | WGNPJXYWDGCQNJ-ZSULRLJQSA-N |
| XLogP | 4.24 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|