C27H29ClF3N2O9P — CID 149233353
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphoryl]amino]propanoate (PubChem CID 149233353) has the molecular formula C27H29ClF3N2O9P and a molecular weight of 648.96 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 149233353 |
| Molecular Formula | C27H29ClF3N2O9P |
| Molecular Weight | 648.96 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(C(F)F)O[C@@H](N2C=C(Cl)C(=O)CC2=O)[C@@H](F)[C@@H]1O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H29ClF3N2O9P/c1-14(2)40-25(37)15(3)32-43(38,42-18-9-8-16-6-4-5-7-17(16)10-18)39-13-27(26(30)31)23(36)22(29)24(41-27)33-12-19(28)20(34)11-21(33)35/h4-10,12,14-15,22-24,26,36H,11,13H2,1-3H3,(H,32,38)/t15-,22-,23-,24+,27+,43?/m0/s1 |
| InChIKey | XKSWLTUVTFHLIW-IXXZRKBMSA-N |
| XLogP | 4.21 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.96 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|