C12H10F2N2O4S — CID 176809419
5-(difluoromethylsulfanyl)-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione (PubChem CID 176809419) has the molecular formula C12H10F2N2O4S and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-(difluoromethylsulfanyl)-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(difluoromethylsulfanyl)-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 176809419 |
| Molecular Formula | C12H10F2N2O4S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 5-(difluoromethylsulfanyl)-1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@@]1(CO)C=C[C@H](n2cc(SC(F)F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C12H10F2N2O4S/c1-2-12(6-17)4-3-8(20-12)16-5-7(21-10(13)14)9(18)15-11(16)19/h1,3-5,8,10,17H,6H2,(H,15,18,19)/t8-,12+/m1/s1 |
| InChIKey | PYGYOMXCQDXSIM-PELKAZGASA-N |
| XLogP | 0.30 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|