C17H22N2O5Si — CID 56595335
[(2R,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methyl acetate (PubChem CID 56595335) has the molecular formula C17H22N2O5Si and a molecular weight of 362.46 g/mol. Its IUPAC name is [(2R,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methyl acetate.
| Compound Name | [(2R,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methyl acetate |
|---|---|
| PubChem CID | 56595335 |
| Molecular Formula | C17H22N2O5Si |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(2R,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C#C[Si](C)(C)C)C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C17H22N2O5Si/c1-12-10-19(16(22)18-15(12)21)14-6-7-17(24-14,11-23-13(2)20)8-9-25(3,4)5/h6-7,10,14H,11H2,1-5H3,(H,18,21,22)/t14-,17-/m1/s1 |
| InChIKey | SFYZXWSMHBVRHK-RHSMWYFYSA-N |
| XLogP | 1.11 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|