C22H24N3O8P — CID 170368499
methyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170368499) has the molecular formula C22H24N3O8P and a molecular weight of 489.42 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170368499 |
| Molecular Formula | C22H24N3O8P |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | methyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(COP(=O)(N[C@@H](C)C(=O)OC)Oc2ccccc2)C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C22H24N3O8P/c1-5-22(12-11-18(32-22)25-13-15(2)19(26)23-21(25)28)14-31-34(29,24-16(3)20(27)30-4)33-17-9-7-6-8-10-17/h1,6-13,16,18H,14H2,2-4H3,(H,24,29)(H,23,26,28)/t16-,18+,22-,34?/m0/s1 |
| InChIKey | TYOHRRZHMLCHNM-DMVAOKPUSA-N |
| XLogP | 1.66 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|