C31H36N3O8P — CID 169257071
propan-2-yl (2S)-2-[[[(5R)-5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 169257071) has the molecular formula C31H36N3O8P and a molecular weight of 609.62 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(5R)-5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(5R)-5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 169257071 |
| Molecular Formula | C31H36N3O8P |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(5R)-5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | C#C[C@@]1(COP(=O)(N[C@@H](Cc2ccccc2)C(=O)OC(C)C)Oc2ccccc2)C=CC(N(C)/C=C(/C)C(=O)NC=O)O1 |
| InChI | InChI=1S/C31H36N3O8P/c1-6-31(18-17-28(41-31)34(5)20-24(4)29(36)32-22-35)21-39-43(38,42-26-15-11-8-12-16-26)33-27(30(37)40-23(2)3)19-25-13-9-7-10-14-25/h1,7-18,20,22-23,27-28H,19,21H2,2-5H3,(H,33,38)(H,32,35,36)/b24-20-/t27-,28?,31-,43?/m0/s1 |
| InChIKey | SYWIBAADLRMOOZ-WOABMJQJSA-N |
| XLogP | 3.74 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|