C23H32N3O9P — CID 142617617
propan-2-yl (2S)-2-[[[(2R,5R)-5-[[(Z)-3-amino-2-methyl-3-oxoprop-1-enyl]amino]-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 142617617) has the molecular formula C23H32N3O9P and a molecular weight of 525.50 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,5R)-5-[[(Z)-3-amino-2-methyl-3-oxoprop-1-enyl]amino]-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,5R)-5-[[(Z)-3-amino-2-methyl-3-oxoprop-1-enyl]amino]-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 142617617 |
| Molecular Formula | C23H32N3O9P |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,5R)-5-[[(Z)-3-amino-2-methyl-3-oxoprop-1-enyl]amino]-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@@H](N/C=C(/C)C(N)=O)C(O)C1O |
| InChI | InChI=1S/C23H32N3O9P/c1-6-23(19(28)18(27)21(34-23)25-12-15(4)20(24)29)13-32-36(31,35-17-10-8-7-9-11-17)26-16(5)22(30)33-14(2)3/h1,7-12,14,16,18-19,21,25,27-28H,13H2,2-5H3,(H2,24,29)(H,26,31)/b15-12-/t16-,18?,19?,21+,23+,36?/m0/s1 |
| InChIKey | YLJWUZMCJVYUPK-GIYDOTOMSA-N |
| XLogP | 0.55 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|