C24H31N4O10P — CID 177364812
propan-2-yl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 177364812) has the molecular formula C24H31N4O10P and a molecular weight of 566.50 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 177364812 |
| Molecular Formula | C24H31N4O10P |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COc1ncc([C@@H]2O[C@](C#N)(CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)[C@H]2O)c(OC)n1 |
| InChI | InChI=1S/C24H31N4O10P/c1-14(2)36-22(31)15(3)28-39(32,38-16-9-7-6-8-10-16)35-13-24(12-25)20(30)18(29)19(37-24)17-11-26-23(34-5)27-21(17)33-4/h6-11,14-15,18-20,29-30H,13H2,1-5H3,(H,28,32)/t15-,18-,19-,20-,24+,39-/m0/s1 |
| InChIKey | FMXMPGOKMPLZTG-LFHIODGUSA-N |
| XLogP | 1.68 |
| TPSA | 191.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|