C27H40N3O10P — CID 177364803
2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 177364803) has the molecular formula C27H40N3O10P and a molecular weight of 597.60 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 177364803 |
| Molecular Formula | C27H40N3O10P |
| Molecular Weight | 597.60 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(2,4-dimethoxypyrimidin-5-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(OC[C@@]1(C)O[C@@H](c2cnc(OC)nc2OC)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H40N3O10P/c1-7-18(8-2)15-37-25(33)17(3)30-41(34,40-19-12-10-9-11-13-19)38-16-27(4)23(32)21(31)22(39-27)20-14-28-26(36-6)29-24(20)35-5/h9-14,17-18,21-23,31-32H,7-8,15-16H2,1-6H3,(H,30,34)/t17-,21-,22-,23-,27+,41-/m0/s1 |
| InChIKey | PIGMKMJVNUNSGU-VNEWSNSMSA-N |
| XLogP | 3.21 |
| TPSA | 167.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|