C28H37N6O8P — CID 145387905
2-ethylbutyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 145387905) has the molecular formula C28H37N6O8P and a molecular weight of 616.61 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145387905 |
| Molecular Formula | C28H37N6O8P |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(OCC1(C)O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C28H37N6O8P/c1-5-19(6-2)14-39-26(37)18(3)33-43(38,41-20-10-8-7-9-11-20)40-16-27(4)23(35)24(36)28(15-29,42-27)22-13-12-21-25(30)31-17-32-34(21)22/h7-13,17-19,23-24,35-36H,5-6,14,16H2,1-4H3,(H,33,38)(H2,30,31,32)/t18-,23-,24+,27?,28-,43-/m0/s1 |
| InChIKey | ZGEGEUCTGBFHST-SYPUQFNZSA-N |
| XLogP | 2.70 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|