C26H29N6O8P — CID 147561681
cyclobutyl (2S)-2-[[[(2R,3S,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 147561681) has the molecular formula C26H29N6O8P and a molecular weight of 584.53 g/mol. Its IUPAC name is cyclobutyl (2S)-2-[[[(2R,3S,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclobutyl (2S)-2-[[[(2R,3S,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 147561681 |
| Molecular Formula | C26H29N6O8P |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | cyclobutyl (2S)-2-[[[(2R,3S,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1ccccc1)O[C@@H]1C[C@@]12O[C@@](C#N)(c1ccc3c(N)ncnn13)[C@H](O)[C@@H]2O)C(=O)OC1CCC1 |
| InChI | InChI=1S/C26H29N6O8P/c1-15(24(35)37-16-8-5-9-16)31-41(36,38-17-6-3-2-4-7-17)39-20-12-25(20)21(33)22(34)26(13-27,40-25)19-11-10-18-23(28)29-14-30-32(18)19/h2-4,6-7,10-11,14-16,20-22,33-34H,5,8-9,12H2,1H3,(H,31,36)(H2,28,29,30)/t15-,20+,21-,22+,25+,26-,41?/m0/s1 |
| InChIKey | FSTOBRVXFUAGMP-HWMTUVBQSA-N |
| XLogP | 1.57 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|