C17H21N6O8P — CID 163693147
[(2R,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid (PubChem CID 163693147) has the molecular formula C17H21N6O8P and a molecular weight of 468.36 g/mol. Its IUPAC name is [(2R,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid.
| Compound Name | [(2R,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 163693147 |
| Molecular Formula | C17H21N6O8P |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [(2R,5R,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-6,7-dihydroxy-4-oxaspiro[2.4]heptan-2-yl]oxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid |
| SMILES | COC(=O)C(C)NP(=O)(O)O[C@@H]1CC12O[C@@](C#N)(c1ccc3c(N)ncnn13)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C17H21N6O8P/c1-8(15(26)29-2)22-32(27,28)30-11-5-16(11)12(24)13(25)17(6-18,31-16)10-4-3-9-14(19)20-7-21-23(9)10/h3-4,7-8,11-13,24-25H,5H2,1-2H3,(H2,19,20,21)(H2,22,27,28)/t8?,11-,12+,13-,16?,17+/m1/s1 |
| InChIKey | JURKIVWNCXBTJN-VATMLAADSA-N |
| XLogP | -1.44 |
| TPSA | 214.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|