C15H22N5O11P3 — CID 155091388
[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2,3,4-trimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155091388) has the molecular formula C15H22N5O11P3 and a molecular weight of 541.29 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2,3,4-trimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2,3,4-trimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155091388 |
| Molecular Formula | C15H22N5O11P3 |
| Molecular Weight | 541.29 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2,3,4-trimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@H]1[C@H](C)[C@@](C)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@]1(C#N)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C15H22N5O11P3/c1-9-10(2)15(6-16,12-5-4-11-13(17)18-8-19-20(11)12)29-14(9,3)7-28-33(24,25)31-34(26,27)30-32(21,22)23/h4-5,8-10H,7H2,1-3H3,(H,24,25)(H,26,27)(H2,17,18,19)(H2,21,22,23)/t9-,10+,14+,15+/m0/s1 |
| InChIKey | MHUJXOOENNTMKG-UNNXFLIFSA-N |
| XLogP | 1.43 |
| TPSA | 249.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|