C13H17N5O12P3- — CID 170676918
[[[(1R,2S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 170676918) has the molecular formula C13H17N5O12P3- and a molecular weight of 528.22 g/mol. Its IUPAC name is [[[(1R,2S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[[(1R,2S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 170676918 |
| Molecular Formula | C13H17N5O12P3- |
| Molecular Weight | 528.22 g/mol |
| Exact Mass | 528.01 |
| IUPAC Name | [[[(1R,2S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)C[C@H](COP(=O)(O)OP(=O)(O)OP(=O)([O-])O)[C@H](O)C1O |
| InChI | InChI=1S/C13H18N5O12P3/c14-5-13(9-2-1-8-12(15)16-6-17-18(8)9)3-7(10(19)11(13)20)4-28-32(24,25)30-33(26,27)29-31(21,22)23/h1-2,6-7,10-11,19-20H,3-4H2,(H,24,25)(H,26,27)(H2,15,16,17)(H2,21,22,23)/p-1/t7-,10+,11?,13-/m1/s1 |
| InChIKey | LIBRZSJKOHJWLO-CQRMKTPLSA-M |
| XLogP | -1.47 |
| TPSA | 283.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.22 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|