C19H21F2N5O5 — CID 169066166
[(1R,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methyl (3,3-difluorocyclobutyl)methyl carbonate (PubChem CID 169066166) has the molecular formula C19H21F2N5O5 and a molecular weight of 437.40 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methyl (3,3-difluorocyclobutyl)methyl carbonate.
| Compound Name | [(1R,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methyl (3,3-difluorocyclobutyl)methyl carbonate |
|---|---|
| PubChem CID | 169066166 |
| Molecular Formula | C19H21F2N5O5 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [(1R,2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,3-dihydroxycyclopentyl]methyl (3,3-difluorocyclobutyl)methyl carbonate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)C[C@H](COC(=O)OCC2CC(F)(F)C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H21F2N5O5/c20-19(21)3-10(4-19)6-30-17(29)31-7-11-5-18(8-22,15(28)14(11)27)13-2-1-12-16(23)24-9-25-26(12)13/h1-2,9-11,14-15,27-28H,3-7H2,(H2,23,24,25)/t11-,14-,15-,18-/m1/s1 |
| InChIKey | VUNKSJIYWRFURR-XKLVTHTNSA-N |
| XLogP | 1.01 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |