C17H15N7O6 — CID 169042954
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl pyrimidin-2-yl carbonate (PubChem CID 169042954) has the molecular formula C17H15N7O6 and a molecular weight of 413.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl pyrimidin-2-yl carbonate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl pyrimidin-2-yl carbonate |
|---|---|
| PubChem CID | 169042954 |
| Molecular Formula | C17H15N7O6 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl pyrimidin-2-yl carbonate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COC(=O)Oc2ncccn2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H15N7O6/c18-7-17(11-3-2-9-14(19)22-8-23-24(9)11)13(26)12(25)10(30-17)6-28-16(27)29-15-20-4-1-5-21-15/h1-5,8,10,12-13,25-26H,6H2,(H2,19,22,23)/t10-,12-,13-,17+/m1/s1 |
| InChIKey | VZDVTTYINWPFJK-MDCUPZMDSA-N |
| XLogP | -0.84 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |