C13H13N5O5 — CID 167006293
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl formate (PubChem CID 167006293) has the molecular formula C13H13N5O5 and a molecular weight of 319.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl formate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl formate |
|---|---|
| PubChem CID | 167006293 |
| Molecular Formula | C13H13N5O5 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl formate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COC=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H13N5O5/c14-4-13(11(21)10(20)8(23-13)3-22-6-19)9-2-1-7-12(15)16-5-17-18(7)9/h1-2,5-6,8,10-11,20-21H,3H2,(H2,15,16,17)/t8-,10-,11-,13+/m1/s1 |
| InChIKey | JQDNWPUDNNZGPX-VUXODMRMSA-N |
| XLogP | -1.68 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|