C19H24N6O5 — CID 171753894
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(3-aminocyclopentyl)acetate (PubChem CID 171753894) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(3-aminocyclopentyl)acetate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(3-aminocyclopentyl)acetate |
|---|---|
| PubChem CID | 171753894 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(3-aminocyclopentyl)acetate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COC(=O)CC2CCC(N)C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H24N6O5/c20-8-19(14-4-3-12-18(22)23-9-24-25(12)14)17(28)16(27)13(30-19)7-29-15(26)6-10-1-2-11(21)5-10/h3-4,9-11,13,16-17,27-28H,1-2,5-7,21H2,(H2,22,23,24)/t10?,11?,13-,16-,17-,19+/m1/s1 |
| InChIKey | AMEHZFRNMIAOTA-PIJGAZOFSA-N |
| XLogP | -0.79 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |