C19H23N5O7S — CID 166530733
[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1,1-dioxothian-4-yl)acetate (PubChem CID 166530733) has the molecular formula C19H23N5O7S and a molecular weight of 465.49 g/mol. Its IUPAC name is [(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1,1-dioxothian-4-yl)acetate.
| Compound Name | [(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1,1-dioxothian-4-yl)acetate |
|---|---|
| PubChem CID | 166530733 |
| Molecular Formula | C19H23N5O7S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | [(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1,1-dioxothian-4-yl)acetate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)OC(COC(=O)CC2CCS(=O)(=O)CC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23N5O7S/c20-9-19(14-2-1-12-18(21)22-10-23-24(12)14)17(27)16(26)13(31-19)8-30-15(25)7-11-3-5-32(28,29)6-4-11/h1-2,10-11,13,16-17,26-27H,3-8H2,(H2,21,22,23)/t13?,16-,17-,19+/m1/s1 |
| InChIKey | MPJNJDIGUSCXAR-TVYZGECOSA-N |
| XLogP | -1.09 |
| TPSA | 190.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |