C27H29N5O6 — CID 170056944
[(2R,3S,4R)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate (PubChem CID 170056944) has the molecular formula C27H29N5O6 and a molecular weight of 519.56 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate.
| Compound Name | [(2R,3S,4R)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate |
|---|---|
| PubChem CID | 170056944 |
| Molecular Formula | C27H29N5O6 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | [(2R,3S,4R)-5-(4-benzamidopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate |
| SMILES | N#CC1(c2ccc3c(NC(=O)c4ccccc4)ncnn23)O[C@H](COC(=O)CC2CCCCC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H29N5O6/c28-15-27(24(35)23(34)20(38-27)14-37-22(33)13-17-7-3-1-4-8-17)21-12-11-19-25(29-16-30-32(19)21)31-26(36)18-9-5-2-6-10-18/h2,5-6,9-12,16-17,20,23-24,34-35H,1,3-4,7-8,13-14H2,(H,29,30,31,36)/t20-,23-,24-,27?/m1/s1 |
| InChIKey | QYKNXPLTEZNFAM-OTXCADGQSA-N |
| XLogP | 2.33 |
| TPSA | 159.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |