C26H36N6O6 — CID 166531586
[(2R,3S,4R,5R)-5-cyano-5-[4-[(2-cyclohexylacetyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3,3-dimethylbutanoate (PubChem CID 166531586) has the molecular formula C26H36N6O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-5-[4-[(2-cyclohexylacetyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3,3-dimethylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-5-[4-[(2-cyclohexylacetyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 166531586 |
| Molecular Formula | C26H36N6O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-5-[4-[(2-cyclohexylacetyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](N)C(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(NC(=O)CC4CCCCC4)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H36N6O6/c1-25(2,3)21(28)24(36)37-12-17-20(34)22(35)26(13-27,38-17)18-10-9-16-23(29-14-30-32(16)18)31-19(33)11-15-7-5-4-6-8-15/h9-10,14-15,17,20-22,34-35H,4-8,11-12,28H2,1-3H3,(H,29,30,31,33)/t17-,20-,21-,22-,26+/m1/s1 |
| InChIKey | IVYJYUZEERZUCU-GYPUHBRYSA-N |
| XLogP | 1.39 |
| TPSA | 185.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |